C12H19ClFN3O3S — CID 119404849
N-(3-aminopropyl)-3-[(4-fluorophenyl)sulfonylamino]propanamide;hydrochloride (PubChem CID 119404849) has the molecular formula C12H19ClFN3O3S and a molecular weight of 339.82 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-[(4-fluorophenyl)sulfonylamino]propanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3-[(4-fluorophenyl)sulfonylamino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119404849 |
| Molecular Formula | C12H19ClFN3O3S |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-(3-aminopropyl)-3-[(4-fluorophenyl)sulfonylamino]propanamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)CCNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H18FN3O3S.ClH/c13-10-2-4-11(5-3-10)20(18,19)16-9-6-12(17)15-8-1-7-14;/h2-5,16H,1,6-9,14H2,(H,15,17);1H |
| InChIKey | TYUJDBYZHSMTSJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|