C20H32N2O3S — CID 15995514
N-butyl-N-methyl-4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide (PubChem CID 15995514) has the molecular formula C20H32N2O3S and a molecular weight of 380.55 g/mol. Its IUPAC name is N-butyl-N-methyl-4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide.
| Compound Name | N-butyl-N-methyl-4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 15995514 |
| Molecular Formula | C20H32N2O3S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-butyl-N-methyl-4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCC(CNS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C20H32N2O3S/c1-4-5-14-22(3)20(23)18-10-8-17(9-11-18)15-21-26(24,25)19-12-6-16(2)7-13-19/h6-7,12-13,17-18,21H,4-5,8-11,14-15H2,1-3H3 |
| InChIKey | SIZYYYXFSXVMMU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |