C15H23N3O3S — CID 119807200
N-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]pyrrolidine-3-carboxamide (PubChem CID 119807200) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | N-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119807200 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]pyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCN(C)C(=O)C2CCNC2)cc1 |
| InChI | InChI=1S/C15H23N3O3S/c1-12-3-5-14(6-4-12)22(20,21)17-9-10-18(2)15(19)13-7-8-16-11-13/h3-6,13,16-17H,7-11H2,1-2H3 |
| InChIKey | NUYVAPAHYUUQJF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |