C22H35F3N2O4S — CID 91546825
N-[[4-[4-[2-methoxyethyl(methyl)amino]butoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 91546825) has the molecular formula C22H35F3N2O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-[[4-[4-[2-methoxyethyl(methyl)amino]butoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[[4-[4-[2-methoxyethyl(methyl)amino]butoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91546825 |
| Molecular Formula | C22H35F3N2O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-[[4-[4-[2-methoxyethyl(methyl)amino]butoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | COCCN(C)CCCCOC1CCC(CNS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H35F3N2O4S/c1-27(14-16-30-2)13-3-4-15-31-20-9-5-18(6-10-20)17-26-32(28,29)21-11-7-19(8-12-21)22(23,24)25/h7-8,11-12,18,20,26H,3-6,9-10,13-17H2,1-2H3 |
| InChIKey | MTQVPUDKQLDRLO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|