C23H36F3N3O3S — CID 69199165
1-[[methyl-[4-[5-[methyl(prop-2-enyl)amino]pentoxy]cyclohexyl]sulfamoyl]amino]-4-(trifluoromethyl)benzene (PubChem CID 69199165) has the molecular formula C23H36F3N3O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is 1-[[methyl-[4-[5-[methyl(prop-2-enyl)amino]pentoxy]cyclohexyl]sulfamoyl]amino]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[[methyl-[4-[5-[methyl(prop-2-enyl)amino]pentoxy]cyclohexyl]sulfamoyl]amino]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 69199165 |
| Molecular Formula | C23H36F3N3O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 1-[[methyl-[4-[5-[methyl(prop-2-enyl)amino]pentoxy]cyclohexyl]sulfamoyl]amino]-4-(trifluoromethyl)benzene |
| SMILES | C=CCN(C)CCCCCOC1CCC(N(C)S(=O)(=O)Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H36F3N3O3S/c1-4-16-28(2)17-6-5-7-18-32-22-14-12-21(13-15-22)29(3)33(30,31)27-20-10-8-19(9-11-20)23(24,25)26/h4,8-11,21-22,27H,1,5-7,12-18H2,2-3H3 |
| InChIKey | ZXZLZVBSAOOGCL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|