C20H38N2O3 — CID 69197678
tert-butyl N-methyl-N-[4-[4-[methyl(prop-2-enyl)amino]butoxy]cyclohexyl]carbamate (PubChem CID 69197678) has the molecular formula C20H38N2O3 and a molecular weight of 354.54 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[4-[4-[methyl(prop-2-enyl)amino]butoxy]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[4-[4-[methyl(prop-2-enyl)amino]butoxy]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 69197678 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | tert-butyl N-methyl-N-[4-[4-[methyl(prop-2-enyl)amino]butoxy]cyclohexyl]carbamate |
| SMILES | C=CCN(C)CCCCOC1CCC(N(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H38N2O3/c1-7-14-21(5)15-8-9-16-24-18-12-10-17(11-13-18)22(6)19(23)25-20(2,3)4/h7,17-18H,1,8-16H2,2-6H3 |
| InChIKey | NNDMHVPQUCYMPZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|