C24H40N2O4 — CID 69198867
benzyl N-[4-[6-[2-hydroxyethyl(methyl)amino]hexoxy]cyclohexyl]-N-methylcarbamate (PubChem CID 69198867) has the molecular formula C24H40N2O4 and a molecular weight of 420.59 g/mol. Its IUPAC name is benzyl N-[4-[6-[2-hydroxyethyl(methyl)amino]hexoxy]cyclohexyl]-N-methylcarbamate.
| Compound Name | benzyl N-[4-[6-[2-hydroxyethyl(methyl)amino]hexoxy]cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 69198867 |
| Molecular Formula | C24H40N2O4 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | benzyl N-[4-[6-[2-hydroxyethyl(methyl)amino]hexoxy]cyclohexyl]-N-methylcarbamate |
| SMILES | CN(CCO)CCCCCCOC1CCC(N(C)C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H40N2O4/c1-25(17-18-27)16-8-3-4-9-19-29-23-14-12-22(13-15-23)26(2)24(28)30-20-21-10-6-5-7-11-21/h5-7,10-11,22-23,27H,3-4,8-9,12-20H2,1-2H3 |
| InChIKey | ABTWXYFWTBZBEN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|