C14H19NO4 — CID 144529181
benzyl N-[(3S)-3,4-dihydroxycyclopentyl]-N-methylcarbamate (PubChem CID 144529181) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is benzyl N-[(3S)-3,4-dihydroxycyclopentyl]-N-methylcarbamate.
| Compound Name | benzyl N-[(3S)-3,4-dihydroxycyclopentyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 144529181 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | benzyl N-[(3S)-3,4-dihydroxycyclopentyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ccccc1)C1CC(O)[C@@H](O)C1 |
| InChI | InChI=1S/C14H19NO4/c1-15(11-7-12(16)13(17)8-11)14(18)19-9-10-5-3-2-4-6-10/h2-6,11-13,16-17H,7-9H2,1H3/t11?,12-,13?/m0/s1 |
| InChIKey | JIUXVQQKPKPWJV-CPCZMJQVSA-N |
| XLogP | 1.14 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |