C15H21NO4 — CID 67475983
benzyl N-[(1R,3R,4S)-3,4-dihydroxycyclohexyl]-N-methylcarbamate (PubChem CID 67475983) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is benzyl N-[(1R,3R,4S)-3,4-dihydroxycyclohexyl]-N-methylcarbamate.
| Compound Name | benzyl N-[(1R,3R,4S)-3,4-dihydroxycyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 67475983 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | benzyl N-[(1R,3R,4S)-3,4-dihydroxycyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ccccc1)[C@@H]1CC[C@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C15H21NO4/c1-16(12-7-8-13(17)14(18)9-12)15(19)20-10-11-5-3-2-4-6-11/h2-6,12-14,17-18H,7-10H2,1H3/t12-,13+,14-/m1/s1 |
| InChIKey | BXLOOHRDMNTTFB-HZSPNIEDSA-N |
| XLogP | 1.53 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |