C26H43ClN2O3 — CID 70021465
(4-chlorophenyl) N-methyl-N-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]carbamate (PubChem CID 70021465) has the molecular formula C26H43ClN2O3 and a molecular weight of 467.09 g/mol. Its IUPAC name is (4-chlorophenyl) N-methyl-N-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]carbamate.
| Compound Name | (4-chlorophenyl) N-methyl-N-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 70021465 |
| Molecular Formula | C26H43ClN2O3 |
| Molecular Weight | 467.09 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | (4-chlorophenyl) N-methyl-N-[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]carbamate |
| SMILES | CCCCCN(C)CCCCCCOC1CCC(N(C)C(=O)Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H43ClN2O3/c1-4-5-8-19-28(2)20-9-6-7-10-21-31-24-17-13-23(14-18-24)29(3)26(30)32-25-15-11-22(27)12-16-25/h11-12,15-16,23-24H,4-10,13-14,17-21H2,1-3H3 |
| InChIKey | GNPHBEDLZOYDHZ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.09 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|