About (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate
(4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate (PubChem CID 10270911) has the molecular formula C21H29ClN2O2
and a molecular weight of 376.93 g/mol. Its IUPAC name is (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate.
Molecular Properties
| Compound Name | (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate |
| PubChem CID | 10270911 |
| Molecular Formula | C21H29ClN2O2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate |
| SMILES | CCCN(C)CC#CC1CCC(N(C)C(=O)Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H29ClN2O2/c1-4-15-23(2)16-5-6-17-7-11-19(12-8-17)24(3)21(25)26-20-13-9-18(22)10-14-20/h9-10,13-14,17,19H,4,7-8,11-12,15-16H2,1-3H3 |
| InChIKey | DGZLMTMEUDYGPO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate?
The IUPAC name of (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate (CID 10270911) is (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate.
What is the SMILES notation for (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate?
The canonical SMILES for (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate is CCCN(C)CC#CC1CCC(N(C)C(=O)Oc2ccc(Cl)cc2)CC1.
What is the InChIKey of (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate?
The InChIKey is DGZLMTMEUDYGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29ClN2O2/c1-4-15-23(2)16-5-6-17-7-11-19(12-8-17)24(3)21(25)26-20-13-9-18(22)10-14-20/h9-10,13-14,17,19H,4,7-8,11-12,15-16H2,1-3H3.
What are the key properties of (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate?
(4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate has a molecular weight of 376.93 g/mol, XLogP of 4.67, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate is sourced from PubChem (CID 10270911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).