C21H29ClN2O2 — CID 10270911
(4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate (PubChem CID 10270911) has the molecular formula C21H29ClN2O2 and a molecular weight of 376.93 g/mol. Its IUPAC name is (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate.
| Compound Name | (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 10270911 |
| Molecular Formula | C21H29ClN2O2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (4-chlorophenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate |
| SMILES | CCCN(C)CC#CC1CCC(N(C)C(=O)Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H29ClN2O2/c1-4-15-23(2)16-5-6-17-7-11-19(12-8-17)24(3)21(25)26-20-13-9-18(22)10-14-20/h9-10,13-14,17,19H,4,7-8,11-12,15-16H2,1-3H3 |
| InChIKey | DGZLMTMEUDYGPO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|