C22H32N2O3 — CID 69198913
(4-methoxyphenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate (PubChem CID 69198913) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is (4-methoxyphenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate.
| Compound Name | (4-methoxyphenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 69198913 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | (4-methoxyphenyl) N-methyl-N-[4-[3-[methyl(propyl)amino]prop-1-ynyl]cyclohexyl]carbamate |
| SMILES | CCCN(C)CC#CC1CCC(N(C)C(=O)Oc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C22H32N2O3/c1-5-16-23(2)17-6-7-18-8-10-19(11-9-18)24(3)22(25)27-21-14-12-20(26-4)13-15-21/h12-15,18-19H,5,8-11,16-17H2,1-4H3 |
| InChIKey | JGZJDZGKCXJIGQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|