About (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride
(4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride (PubChem CID 45259199) has the molecular formula C11H17ClN2O3
and a molecular weight of 260.72 g/mol. Its IUPAC name is (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride |
| PubChem CID | 45259199 |
| Molecular Formula | C11H17ClN2O3 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride |
| SMILES | COc1ccc(OC(=O)N(C)CCN)cc1.Cl |
| InChI | InChI=1S/C11H16N2O3.ClH/c1-13(8-7-12)11(14)16-10-5-3-9(15-2)4-6-10;/h3-6H,7-8,12H2,1-2H3;1H |
| InChIKey | QWGDDVHXLJTSMS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride?
The IUPAC name of (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride (CID 45259199) is (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride.
What is the SMILES notation for (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride?
The canonical SMILES for (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride is COc1ccc(OC(=O)N(C)CCN)cc1.Cl.
What is the InChIKey of (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride?
The InChIKey is QWGDDVHXLJTSMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3.ClH/c1-13(8-7-12)11(14)16-10-5-3-9(15-2)4-6-10;/h3-6H,7-8,12H2,1-2H3;1H.
What are the key properties of (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride?
(4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride has a molecular weight of 260.72 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) N-(2-aminoethyl)-N-methylcarbamate;hydrochloride is sourced from PubChem (CID 45259199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).