About (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate
(3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate (PubChem CID 116819944) has the molecular formula C13H16N2O4
and a molecular weight of 264.28 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate.
Molecular Properties
| Compound Name | (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate |
| PubChem CID | 116819944 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate |
| SMILES | COc1cc(OC)cc(OC(=O)N(C)CCC#N)c1 |
| InChI | InChI=1S/C13H16N2O4/c1-15(6-4-5-14)13(16)19-12-8-10(17-2)7-11(9-12)18-3/h7-9H,4,6H2,1-3H3 |
| InChIKey | XMGDVCQMKRYORB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate?
The IUPAC name of (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate (CID 116819944) is (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate.
What is the SMILES notation for (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate?
The canonical SMILES for (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate is COc1cc(OC)cc(OC(=O)N(C)CCC#N)c1.
What is the InChIKey of (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate?
The InChIKey is XMGDVCQMKRYORB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4/c1-15(6-4-5-14)13(16)19-12-8-10(17-2)7-11(9-12)18-3/h7-9H,4,6H2,1-3H3.
What are the key properties of (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate?
(3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate has a molecular weight of 264.28 g/mol, XLogP of 2.05, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethoxyphenyl) N-(2-cyanoethyl)-N-methylcarbamate is sourced from PubChem (CID 116819944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).