C14H19N3O4 — CID 3643466
1-(2-cyanoethyl)-1-methyl-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 3643466) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-1-methyl-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-(2-cyanoethyl)-1-methyl-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 3643466 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-(2-cyanoethyl)-1-methyl-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)N(C)CCC#N)cc(OC)c1OC |
| InChI | InChI=1S/C14H19N3O4/c1-17(7-5-6-15)14(18)16-10-8-11(19-2)13(21-4)12(9-10)20-3/h8-9H,5,7H2,1-4H3,(H,16,18) |
| InChIKey | AQYDJUXOEOYNAM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |