C13H17N3O2 — CID 3859282
1-(2-cyanoethyl)-3-(2-methoxy-5-methylphenyl)-1-methylurea (PubChem CID 3859282) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-(2-methoxy-5-methylphenyl)-1-methylurea.
| Compound Name | 1-(2-cyanoethyl)-3-(2-methoxy-5-methylphenyl)-1-methylurea |
|---|---|
| PubChem CID | 3859282 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-(2-cyanoethyl)-3-(2-methoxy-5-methylphenyl)-1-methylurea |
| SMILES | COc1ccc(C)cc1NC(=O)N(C)CCC#N |
| InChI | InChI=1S/C13H17N3O2/c1-10-5-6-12(18-3)11(9-10)15-13(17)16(2)8-4-7-14/h5-6,9H,4,8H2,1-3H3,(H,15,17) |
| InChIKey | YPPHAJGEGRSJHF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |