C11H18N2O2 — CID 142042876
ethane;(2-methoxy-5-methylphenyl)urea (PubChem CID 142042876) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is ethane;(2-methoxy-5-methylphenyl)urea.
| Compound Name | ethane;(2-methoxy-5-methylphenyl)urea |
|---|---|
| PubChem CID | 142042876 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | ethane;(2-methoxy-5-methylphenyl)urea |
| SMILES | CC.COc1ccc(C)cc1NC(N)=O |
| InChI | InChI=1S/C9H12N2O2.C2H6/c1-6-3-4-8(13-2)7(5-6)11-9(10)12;1-2/h3-5H,1-2H3,(H3,10,11,12);1-2H3 |
| InChIKey | SCEBOCXHXTUDPV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |