C17H20N4O2 — CID 157197459
[2-[(2-methoxy-4,5-dimethylphenyl)diazenyl]-5-methylphenyl]urea (PubChem CID 157197459) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is [2-[(2-methoxy-4,5-dimethylphenyl)diazenyl]-5-methylphenyl]urea.
| Compound Name | [2-[(2-methoxy-4,5-dimethylphenyl)diazenyl]-5-methylphenyl]urea |
|---|---|
| PubChem CID | 157197459 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [2-[(2-methoxy-4,5-dimethylphenyl)diazenyl]-5-methylphenyl]urea |
| SMILES | COc1cc(C)c(C)cc1/N=N/c1ccc(C)cc1NC(N)=O |
| InChI | InChI=1S/C17H20N4O2/c1-10-5-6-13(14(7-10)19-17(18)22)20-21-15-8-11(2)12(3)9-16(15)23-4/h5-9H,1-4H3,(H3,18,19,22)/b21-20+ |
| InChIKey | SKRZOYLNNGXCMZ-QZQOTICOSA-N |
| XLogP | 4.53 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|