C15H18N4O — CID 58654539
4-[(2-methoxy-4-methylphenyl)diazenyl]-6-methylbenzene-1,3-diamine (PubChem CID 58654539) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 4-[(2-methoxy-4-methylphenyl)diazenyl]-6-methylbenzene-1,3-diamine.
| Compound Name | 4-[(2-methoxy-4-methylphenyl)diazenyl]-6-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 58654539 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4-[(2-methoxy-4-methylphenyl)diazenyl]-6-methylbenzene-1,3-diamine |
| SMILES | COc1cc(C)ccc1/N=N/c1cc(C)c(N)cc1N |
| InChI | InChI=1S/C15H18N4O/c1-9-4-5-13(15(6-9)20-3)18-19-14-7-10(2)11(16)8-12(14)17/h4-8H,16-17H2,1-3H3/b19-18+ |
| InChIKey | NOFQQZVAQCGYDQ-VHEBQXMUSA-N |
| XLogP | 3.89 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|