C15H17N3O — CID 118049560
4-[(3,4-dimethylphenyl)diazenyl]-3-methoxyaniline (PubChem CID 118049560) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)diazenyl]-3-methoxyaniline.
| Compound Name | 4-[(3,4-dimethylphenyl)diazenyl]-3-methoxyaniline |
|---|---|
| PubChem CID | 118049560 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)diazenyl]-3-methoxyaniline |
| SMILES | COc1cc(N)ccc1/N=N/c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H17N3O/c1-10-4-6-13(8-11(10)2)17-18-14-7-5-12(16)9-15(14)19-3/h4-9H,16H2,1-3H3/b18-17+ |
| InChIKey | XRAZBNYSMBCAMP-ISLYRVAYSA-N |
| XLogP | 4.31 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|