C23H25N5O — CID 148790382
4-[[4-[(4-methoxy-2-methylphenyl)diazenyl]-3-methylphenyl]diazenyl]-2,5-dimethylaniline (PubChem CID 148790382) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is 4-[[4-[(4-methoxy-2-methylphenyl)diazenyl]-3-methylphenyl]diazenyl]-2,5-dimethylaniline.
| Compound Name | 4-[[4-[(4-methoxy-2-methylphenyl)diazenyl]-3-methylphenyl]diazenyl]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 148790382 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 4-[[4-[(4-methoxy-2-methylphenyl)diazenyl]-3-methylphenyl]diazenyl]-2,5-dimethylaniline |
| SMILES | COc1ccc(/N=N/c2ccc(/N=N/c3cc(C)c(N)cc3C)cc2C)c(C)c1 |
| InChI | InChI=1S/C23H25N5O/c1-14-13-23(17(4)12-20(14)24)28-25-18-6-8-21(15(2)10-18)26-27-22-9-7-19(29-5)11-16(22)3/h6-13H,24H2,1-5H3/b27-26+,28-25+ |
| InChIKey | OMAVBVSHGVZPAM-JOSXGXAISA-N |
| XLogP | 7.34 |
| TPSA | 84.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|