C50H54N6O5 — CID 88703398
[5-methoxy-2-methyl-4-[[2-methyl-4-(4-pentoxyphenoxy)phenyl]diazenyl]phenyl]-[4-[[2-methyl-4-(4-pentoxyphenoxy)phenyl]diazenyl]phenyl]diazene (PubChem CID 88703398) has the molecular formula C50H54N6O5 and a molecular weight of 819.02 g/mol. Its IUPAC name is [5-methoxy-2-methyl-4-[[2-methyl-4-(4-pentoxyphenoxy)phenyl]diazenyl]phenyl]-[4-[[2-methyl-4-(4-pentoxyphenoxy)phenyl]diazenyl]phenyl]diazene.
| Compound Name | [5-methoxy-2-methyl-4-[[2-methyl-4-(4-pentoxyphenoxy)phenyl]diazenyl]phenyl]-[4-[[2-methyl-4-(4-pentoxyphenoxy)phenyl]diazenyl]phenyl]diazene |
|---|---|
| PubChem CID | 88703398 |
| Molecular Formula | C50H54N6O5 |
| Molecular Weight | 819.02 g/mol |
| Exact Mass | 818.42 |
| IUPAC Name | [5-methoxy-2-methyl-4-[[2-methyl-4-(4-pentoxyphenoxy)phenyl]diazenyl]phenyl]-[4-[[2-methyl-4-(4-pentoxyphenoxy)phenyl]diazenyl]phenyl]diazene |
| SMILES | CCCCCOc1ccc(Oc2ccc(/N=N/c3ccc(/N=N/c4cc(OC)c(/N=N/c5ccc(Oc6ccc(OCCCCC)cc6)cc5C)cc4C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C50H54N6O5/c1-7-9-11-29-58-40-17-21-42(22-18-40)60-44-25-27-46(35(3)31-44)53-51-38-13-15-39(16-14-38)52-55-48-34-50(57-6)49(33-37(48)5)56-54-47-28-26-45(32-36(47)4)61-43-23-19-41(20-24-43)59-30-12-10-8-2/h13-28,31-34H,7-12,29-30H2,1-6H3/b53-51+,55-52+,56-54+ |
| InChIKey | HGWOBNQIESJDTG-SHPLNPRPSA-N |
| XLogP | 16.59 |
| TPSA | 120.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.02 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|