C43H52N6O6 — CID 168837449
6-[4-[[4-[[2-methyl-4-[[4-(6-propanoyloxyhexoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]hexyl propanoate (PubChem CID 168837449) has the molecular formula C43H52N6O6 and a molecular weight of 748.93 g/mol. Its IUPAC name is 6-[4-[[4-[[2-methyl-4-[[4-(6-propanoyloxyhexoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]hexyl propanoate.
| Compound Name | 6-[4-[[4-[[2-methyl-4-[[4-(6-propanoyloxyhexoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]hexyl propanoate |
|---|---|
| PubChem CID | 168837449 |
| Molecular Formula | C43H52N6O6 |
| Molecular Weight | 748.93 g/mol |
| Exact Mass | 748.39 |
| IUPAC Name | 6-[4-[[4-[[2-methyl-4-[[4-(6-propanoyloxyhexoxy)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]phenoxy]hexyl propanoate |
| SMILES | CCC(=O)OCCCCCCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4ccc(OCCCCCCOC(=O)CC)cc4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C43H52N6O6/c1-4-42(50)54-30-12-8-6-10-28-52-39-23-18-36(19-24-39)45-44-34-14-16-35(17-15-34)47-49-41-27-22-38(32-33(41)3)48-46-37-20-25-40(26-21-37)53-29-11-7-9-13-31-55-43(51)5-2/h14-27,32H,4-13,28-31H2,1-3H3/b45-44+,48-46+,49-47+ |
| InChIKey | DWIQISNPCMZGRI-HVZMNSLVSA-N |
| XLogP | 13.03 |
| TPSA | 145.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.93 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|