C35H47N5O5 — CID 166512691
8-[4-[[4-[[4-[bis(2-methoxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenoxy]octyl propanoate (PubChem CID 166512691) has the molecular formula C35H47N5O5 and a molecular weight of 617.79 g/mol. Its IUPAC name is 8-[4-[[4-[[4-[bis(2-methoxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenoxy]octyl propanoate.
| Compound Name | 8-[4-[[4-[[4-[bis(2-methoxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenoxy]octyl propanoate |
|---|---|
| PubChem CID | 166512691 |
| Molecular Formula | C35H47N5O5 |
| Molecular Weight | 617.79 g/mol |
| Exact Mass | 617.36 |
| IUPAC Name | 8-[4-[[4-[[4-[bis(2-methoxyethyl)amino]phenyl]diazenyl]phenyl]diazenyl]phenoxy]octyl propanoate |
| SMILES | CCC(=O)OCCCCCCCCOc1ccc(/N=N/c2ccc(/N=N/c3ccc(N(CCOC)CCOC)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H47N5O5/c1-4-35(41)45-26-10-8-6-5-7-9-25-44-34-21-17-32(18-22-34)39-37-30-13-11-29(12-14-30)36-38-31-15-19-33(20-16-31)40(23-27-42-2)24-28-43-3/h11-22H,4-10,23-28H2,1-3H3/b38-36+,39-37+ |
| InChIKey | UVZZQSULLILRMD-NFSGFYSESA-N |
| XLogP | 9.29 |
| TPSA | 106.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.79 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|