C31H47N3O3 — CID 130352027
4-[4-[[4-(diethylamino)phenyl]diazenyl]phenoxy]butyl 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 130352027) has the molecular formula C31H47N3O3 and a molecular weight of 509.74 g/mol. Its IUPAC name is 4-[4-[[4-(diethylamino)phenyl]diazenyl]phenoxy]butyl 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | 4-[4-[[4-(diethylamino)phenyl]diazenyl]phenoxy]butyl 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 130352027 |
| Molecular Formula | C31H47N3O3 |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.36 |
| IUPAC Name | 4-[4-[[4-(diethylamino)phenyl]diazenyl]phenoxy]butyl 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(OCCCCOC(=O)C(CC(C)(C)C)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H47N3O3/c1-9-34(10-2)26-17-13-24(14-18-26)32-33-25-15-19-27(20-16-25)36-21-11-12-22-37-29(35)28(31(6,7)8)23-30(3,4)5/h13-20,28H,9-12,21-23H2,1-8H3/b33-32+ |
| InChIKey | JEVOZEVCDCIJCT-ULIFNZDWSA-N |
| XLogP | 8.75 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|