C31H45N3O5 — CID 146434282
6-[4-[(4-nitrophenyl)diazenyl]phenoxy]hexyl 4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoate (PubChem CID 146434282) has the molecular formula C31H45N3O5 and a molecular weight of 539.72 g/mol. Its IUPAC name is 6-[4-[(4-nitrophenyl)diazenyl]phenoxy]hexyl 4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoate.
| Compound Name | 6-[4-[(4-nitrophenyl)diazenyl]phenoxy]hexyl 4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoate |
|---|---|
| PubChem CID | 146434282 |
| Molecular Formula | C31H45N3O5 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | 6-[4-[(4-nitrophenyl)diazenyl]phenoxy]hexyl 4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoate |
| SMILES | CCC(C)(C)CC(C(=O)OCCCCCCOc1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1)C(C)(C)CC |
| InChI | InChI=1S/C31H45N3O5/c1-7-30(3,4)23-28(31(5,6)8-2)29(35)39-22-12-10-9-11-21-38-27-19-15-25(16-20-27)33-32-24-13-17-26(18-14-24)34(36)37/h13-20,28H,7-12,21-23H2,1-6H3/b33-32+ |
| InChIKey | VAKULFYUEYQFOU-ULIFNZDWSA-N |
| XLogP | 9.37 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|