C52H68N6O12 — CID 102383801
dihexyl (2S,3R)-2,3-bis[6-[4-[(4-nitrophenyl)diazenyl]phenoxy]hexoxy]butanedioate (PubChem CID 102383801) has the molecular formula C52H68N6O12 and a molecular weight of 969.15 g/mol. Its IUPAC name is dihexyl (2S,3R)-2,3-bis[6-[4-[(4-nitrophenyl)diazenyl]phenoxy]hexoxy]butanedioate.
| Compound Name | dihexyl (2S,3R)-2,3-bis[6-[4-[(4-nitrophenyl)diazenyl]phenoxy]hexoxy]butanedioate |
|---|---|
| PubChem CID | 102383801 |
| Molecular Formula | C52H68N6O12 |
| Molecular Weight | 969.15 g/mol |
| Exact Mass | 968.49 |
| IUPAC Name | dihexyl (2S,3R)-2,3-bis[6-[4-[(4-nitrophenyl)diazenyl]phenoxy]hexoxy]butanedioate |
| SMILES | CCCCCCOC(=O)[C@@H](OCCCCCCOc1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1)[C@@H](OCCCCCCOc1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1)C(=O)OCCCCCC |
| InChI | InChI=1S/C52H68N6O12/c1-3-5-7-13-39-69-51(59)49(67-37-17-11-9-15-35-65-47-31-23-43(24-32-47)55-53-41-19-27-45(28-20-41)57(61)62)50(52(60)70-40-14-8-6-4-2)68-38-18-12-10-16-36-66-48-33-25-44(26-34-48)56-54-42-21-29-46(30-22-42)58(63)64/h19-34,49-50H,3-18,35-40H2,1-2H3/b55-53+,56-54+/t49-,50+ |
| InChIKey | CJIJEIIQYOJJEU-FEWDVUHBSA-N |
| XLogP | 13.93 |
| TPSA | 225.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.15 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|