C21H21N3O4S — CID 58331004
CID 58331004 (PubChem CID 58331004) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol.
| Compound Name | CID 58331004 |
|---|---|
| PubChem CID | 58331004 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | — |
| SMILES | [CH]CCOc1cc(S(=O)(=O)O)c2cc(/N=N/c3cc(C)c(N)cc3C)ccc2c1 |
| InChI | InChI=1S/C21H21N3O4S/c1-4-7-28-17-10-15-5-6-16(11-18(15)21(12-17)29(25,26)27)23-24-20-9-13(2)19(22)8-14(20)3/h1,5-6,8-12H,4,7,22H2,2-3H3,(H,25,26,27)/b24-23+ |
| InChIKey | COGYIRHLULCYJK-WCWDXBQESA-N |
| XLogP | 5.18 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|