C31H35N5O11S3 — CID 161244887
3-[7-[[4-[[4-amino-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]naphthalen-1-yl]oxypropane-1-sulfonic acid;sulfur trioxide (PubChem CID 161244887) has the molecular formula C31H35N5O11S3 and a molecular weight of 749.85 g/mol. Its IUPAC name is 3-[7-[[4-[[4-amino-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]naphthalen-1-yl]oxypropane-1-sulfonic acid;sulfur trioxide.
| Compound Name | 3-[7-[[4-[[4-amino-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]naphthalen-1-yl]oxypropane-1-sulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 161244887 |
| Molecular Formula | C31H35N5O11S3 |
| Molecular Weight | 749.85 g/mol |
| Exact Mass | 749.15 |
| IUPAC Name | 3-[7-[[4-[[4-amino-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]naphthalen-1-yl]oxypropane-1-sulfonic acid;sulfur trioxide |
| SMILES | Cc1cc(/N=N/c2cc(OCCCS(=O)(=O)O)c(N)cc2C)c(C)cc1/N=N/c1ccc2cccc(OCCCS(=O)(=O)O)c2c1.O=S(=O)=O |
| InChI | InChI=1S/C31H35N5O8S2.O3S/c1-20-15-26(32)31(44-12-6-14-46(40,41)42)19-29(20)36-35-28-17-21(2)27(16-22(28)3)34-33-24-10-9-23-7-4-8-30(25(23)18-24)43-11-5-13-45(37,38)39;1-4(2)3/h4,7-10,15-19H,5-6,11-14,32H2,1-3H3,(H,37,38,39)(H,40,41,42);/b34-33+,36-35+; |
| InChIKey | VAMSRXLPPDAJMF-NZOSLDSTSA-N |
| XLogP | 6.49 |
| TPSA | 253.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.85 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|