C27H26ClN5O4S — CID 175983219
3-[2-[(4-amino-2,5-dimethylphenyl)diazenyl]-4-chloro-5-(naphthalen-2-yldiazenyl)phenoxy]propane-1-sulfonic acid (PubChem CID 175983219) has the molecular formula C27H26ClN5O4S and a molecular weight of 552.06 g/mol. Its IUPAC name is 3-[2-[(4-amino-2,5-dimethylphenyl)diazenyl]-4-chloro-5-(naphthalen-2-yldiazenyl)phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(4-amino-2,5-dimethylphenyl)diazenyl]-4-chloro-5-(naphthalen-2-yldiazenyl)phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175983219 |
| Molecular Formula | C27H26ClN5O4S |
| Molecular Weight | 552.06 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 3-[2-[(4-amino-2,5-dimethylphenyl)diazenyl]-4-chloro-5-(naphthalen-2-yldiazenyl)phenoxy]propane-1-sulfonic acid |
| SMILES | Cc1cc(/N=N/c2cc(Cl)c(/N=N/c3ccc4ccccc4c3)cc2OCCCS(=O)(=O)O)c(C)cc1N |
| InChI | InChI=1S/C27H26ClN5O4S/c1-17-13-24(18(2)12-23(17)29)31-33-26-15-22(28)25(16-27(26)37-10-5-11-38(34,35)36)32-30-21-9-8-19-6-3-4-7-20(19)14-21/h3-4,6-9,12-16H,5,10-11,29H2,1-2H3,(H,34,35,36)/b32-30+,33-31+ |
| InChIKey | KRTIUFHDLFPSIO-RRPBDJRISA-N |
| XLogP | 8.18 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.06 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|