C16H19N3O4S — CID 58203236
3-(2-amino-4-methyl-5-phenyldiazenylphenoxy)propane-1-sulfonic acid (PubChem CID 58203236) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-(2-amino-4-methyl-5-phenyldiazenylphenoxy)propane-1-sulfonic acid.
| Compound Name | 3-(2-amino-4-methyl-5-phenyldiazenylphenoxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58203236 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-(2-amino-4-methyl-5-phenyldiazenylphenoxy)propane-1-sulfonic acid |
| SMILES | Cc1cc(N)c(OCCCS(=O)(=O)O)cc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C16H19N3O4S/c1-12-10-14(17)16(23-8-5-9-24(20,21)22)11-15(12)19-18-13-6-3-2-4-7-13/h2-4,6-7,10-11H,5,8-9,17H2,1H3,(H,20,21,22)/b19-18+ |
| InChIKey | LCTCRNIXAUCWTO-VHEBQXMUSA-N |
| XLogP | 3.65 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|