C16H20N4O — CID 12936213
4-butoxy-6-phenyldiazenylbenzene-1,3-diamine (PubChem CID 12936213) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-butoxy-6-phenyldiazenylbenzene-1,3-diamine.
| Compound Name | 4-butoxy-6-phenyldiazenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 12936213 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-butoxy-6-phenyldiazenylbenzene-1,3-diamine |
| SMILES | CCCCOc1cc(/N=N/c2ccccc2)c(N)cc1N |
| InChI | InChI=1S/C16H20N4O/c1-2-3-9-21-16-11-15(13(17)10-14(16)18)20-19-12-7-5-4-6-8-12/h4-8,10-11H,2-3,9,17-18H2,1H3/b20-19+ |
| InChIKey | IGOLEJVTHFLADK-FMQUCBEESA-N |
| XLogP | 4.45 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|