C24H32N2O6 — CID 70354773
dibutyl 4-amino-5-[2-(2-aminophenoxy)ethoxy]benzene-1,2-dicarboxylate (PubChem CID 70354773) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is dibutyl 4-amino-5-[2-(2-aminophenoxy)ethoxy]benzene-1,2-dicarboxylate.
| Compound Name | dibutyl 4-amino-5-[2-(2-aminophenoxy)ethoxy]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 70354773 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | dibutyl 4-amino-5-[2-(2-aminophenoxy)ethoxy]benzene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)c1cc(N)c(OCCOc2ccccc2N)cc1C(=O)OCCCC |
| InChI | InChI=1S/C24H32N2O6/c1-3-5-11-31-23(27)17-15-20(26)22(16-18(17)24(28)32-12-6-4-2)30-14-13-29-21-10-8-7-9-19(21)25/h7-10,15-16H,3-6,11-14,25-26H2,1-2H3 |
| InChIKey | GWHXNVSYGAWYOW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|