About 2-butoxy-5-phenylaniline
2-butoxy-5-phenylaniline (PubChem CID 54853554) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-butoxy-5-phenylaniline.
Molecular Properties
| Compound Name | 2-butoxy-5-phenylaniline |
| PubChem CID | 54853554 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-butoxy-5-phenylaniline |
| SMILES | CCCCOc1ccc(-c2ccccc2)cc1N |
| InChI | InChI=1S/C16H19NO/c1-2-3-11-18-16-10-9-14(12-15(16)17)13-7-5-4-6-8-13/h4-10,12H,2-3,11,17H2,1H3 |
| InChIKey | GQMBJJUQBDIAPQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-5-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-5-phenylaniline?
The IUPAC name of 2-butoxy-5-phenylaniline (CID 54853554) is 2-butoxy-5-phenylaniline.
What is the SMILES notation for 2-butoxy-5-phenylaniline?
The canonical SMILES for 2-butoxy-5-phenylaniline is CCCCOc1ccc(-c2ccccc2)cc1N.
What is the InChIKey of 2-butoxy-5-phenylaniline?
The InChIKey is GQMBJJUQBDIAPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO/c1-2-3-11-18-16-10-9-14(12-15(16)17)13-7-5-4-6-8-13/h4-10,12H,2-3,11,17H2,1H3.
What are the key properties of 2-butoxy-5-phenylaniline?
2-butoxy-5-phenylaniline has a molecular weight of 241.33 g/mol, XLogP of 4.11, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-5-phenylaniline is sourced from PubChem (CID 54853554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).