About 2-butyl-4-phenylaniline
2-butyl-4-phenylaniline (PubChem CID 24835781) has the molecular formula C16H19N
and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-butyl-4-phenylaniline.
Molecular Properties
| Compound Name | 2-butyl-4-phenylaniline |
| PubChem CID | 24835781 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2-butyl-4-phenylaniline |
| SMILES | CCCCc1cc(-c2ccccc2)ccc1N |
| InChI | InChI=1S/C16H19N/c1-2-3-7-15-12-14(10-11-16(15)17)13-8-5-4-6-9-13/h4-6,8-12H,2-3,7,17H2,1H3 |
| InChIKey | UMGSSWXSBGBJIT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-4-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-phenylaniline?
The IUPAC name of 2-butyl-4-phenylaniline (CID 24835781) is 2-butyl-4-phenylaniline.
What is the SMILES notation for 2-butyl-4-phenylaniline?
The canonical SMILES for 2-butyl-4-phenylaniline is CCCCc1cc(-c2ccccc2)ccc1N.
What is the InChIKey of 2-butyl-4-phenylaniline?
The InChIKey is UMGSSWXSBGBJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N/c1-2-3-7-15-12-14(10-11-16(15)17)13-8-5-4-6-9-13/h4-6,8-12H,2-3,7,17H2,1H3.
What are the key properties of 2-butyl-4-phenylaniline?
2-butyl-4-phenylaniline has a molecular weight of 225.34 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-phenylaniline is sourced from PubChem (CID 24835781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).