About 5-phenyl-2-propylaniline
5-phenyl-2-propylaniline (PubChem CID 165495824) has the molecular formula C15H17N
and a molecular weight of 211.31 g/mol. Its IUPAC name is 5-phenyl-2-propylaniline.
Molecular Properties
| Compound Name | 5-phenyl-2-propylaniline |
| PubChem CID | 165495824 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 5-phenyl-2-propylaniline |
| SMILES | CCCc1ccc(-c2ccccc2)cc1N |
| InChI | InChI=1S/C15H17N/c1-2-6-13-9-10-14(11-15(13)16)12-7-4-3-5-8-12/h3-5,7-11H,2,6,16H2,1H3 |
| InChIKey | GCPZKXCNBKMBCW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-2-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-2-propylaniline?
The IUPAC name of 5-phenyl-2-propylaniline (CID 165495824) is 5-phenyl-2-propylaniline.
What is the SMILES notation for 5-phenyl-2-propylaniline?
The canonical SMILES for 5-phenyl-2-propylaniline is CCCc1ccc(-c2ccccc2)cc1N.
What is the InChIKey of 5-phenyl-2-propylaniline?
The InChIKey is GCPZKXCNBKMBCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N/c1-2-6-13-9-10-14(11-15(13)16)12-7-4-3-5-8-12/h3-5,7-11H,2,6,16H2,1H3.
What are the key properties of 5-phenyl-2-propylaniline?
5-phenyl-2-propylaniline has a molecular weight of 211.31 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-2-propylaniline is sourced from PubChem (CID 165495824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).