C24H27N5O7S2 — CID 160788387
3-[2-[(4-amino-2,5-dimethylphenyl)diazenyl]-4-methyl-5-phenyldiazenylphenoxy]propane-1-sulfonic acid;sulfur trioxide (PubChem CID 160788387) has the molecular formula C24H27N5O7S2 and a molecular weight of 561.64 g/mol. Its IUPAC name is 3-[2-[(4-amino-2,5-dimethylphenyl)diazenyl]-4-methyl-5-phenyldiazenylphenoxy]propane-1-sulfonic acid;sulfur trioxide.
| Compound Name | 3-[2-[(4-amino-2,5-dimethylphenyl)diazenyl]-4-methyl-5-phenyldiazenylphenoxy]propane-1-sulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 160788387 |
| Molecular Formula | C24H27N5O7S2 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | 3-[2-[(4-amino-2,5-dimethylphenyl)diazenyl]-4-methyl-5-phenyldiazenylphenoxy]propane-1-sulfonic acid;sulfur trioxide |
| SMILES | Cc1cc(/N=N/c2cc(C)c(/N=N/c3ccccc3)cc2OCCCS(=O)(=O)O)c(C)cc1N.O=S(=O)=O |
| InChI | InChI=1S/C24H27N5O4S.O3S/c1-16-13-21(17(2)12-20(16)25)28-29-23-14-18(3)22(27-26-19-8-5-4-6-9-19)15-24(23)33-10-7-11-34(30,31)32;1-4(2)3/h4-6,8-9,12-15H,7,10-11,25H2,1-3H3,(H,30,31,32);/b27-26+,29-28+; |
| InChIKey | SBMZUIYBVXSUMZ-JEXCGEKGSA-N |
| XLogP | 5.68 |
| TPSA | 190.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|