C30H32N4O6S — CID 130264024
3-[2-amino-4-methyl-5-[[4-[(5-propoxynaphthalen-2-yl)carbamoyl]phenyl]diazenyl]phenoxy]propane-1-sulfonic acid (PubChem CID 130264024) has the molecular formula C30H32N4O6S and a molecular weight of 576.68 g/mol. Its IUPAC name is 3-[2-amino-4-methyl-5-[[4-[(5-propoxynaphthalen-2-yl)carbamoyl]phenyl]diazenyl]phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-amino-4-methyl-5-[[4-[(5-propoxynaphthalen-2-yl)carbamoyl]phenyl]diazenyl]phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 130264024 |
| Molecular Formula | C30H32N4O6S |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 3-[2-amino-4-methyl-5-[[4-[(5-propoxynaphthalen-2-yl)carbamoyl]phenyl]diazenyl]phenoxy]propane-1-sulfonic acid |
| SMILES | CCCOc1cccc2cc(NC(=O)c3ccc(/N=N/c4cc(OCCCS(=O)(=O)O)c(N)cc4C)cc3)ccc12 |
| InChI | InChI=1S/C30H32N4O6S/c1-3-14-39-28-7-4-6-22-18-24(12-13-25(22)28)32-30(35)21-8-10-23(11-9-21)33-34-27-19-29(26(31)17-20(27)2)40-15-5-16-41(36,37)38/h4,6-13,17-19H,3,5,14-16,31H2,1-2H3,(H,32,35)(H,36,37,38)/b34-33+ |
| InChIKey | KVLPPGRGCUDJTM-JEIPZWNWSA-N |
| XLogP | 6.84 |
| TPSA | 152.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|