C18H22N4O5S — CID 166683031
3-[2-amino-5-[(4-carbamoyl-2-methylphenyl)diazenyl]-4-methylphenoxy]propane-1-sulfonic acid (PubChem CID 166683031) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is 3-[2-amino-5-[(4-carbamoyl-2-methylphenyl)diazenyl]-4-methylphenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-amino-5-[(4-carbamoyl-2-methylphenyl)diazenyl]-4-methylphenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 166683031 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 3-[2-amino-5-[(4-carbamoyl-2-methylphenyl)diazenyl]-4-methylphenoxy]propane-1-sulfonic acid |
| SMILES | Cc1cc(C(N)=O)ccc1/N=N/c1cc(OCCCS(=O)(=O)O)c(N)cc1C |
| InChI | InChI=1S/C18H22N4O5S/c1-11-8-13(18(20)23)4-5-15(11)21-22-16-10-17(14(19)9-12(16)2)27-6-3-7-28(24,25)26/h4-5,8-10H,3,6-7,19H2,1-2H3,(H2,20,23)(H,24,25,26)/b22-21+ |
| InChIKey | BMTRWTBZQCIVBM-QURGRASLSA-N |
| XLogP | 3.06 |
| TPSA | 157.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|