C29H40N4O12S3 — CID 158421445
4-(2-amino-4-methylphenoxy)butane-1-sulfonic acid;2-[[4-amino-2-methyl-5-(4-sulfobutoxy)phenyl]diazenyl]-5-methoxybenzenesulfonic acid (PubChem CID 158421445) has the molecular formula C29H40N4O12S3 and a molecular weight of 732.86 g/mol. Its IUPAC name is 4-(2-amino-4-methylphenoxy)butane-1-sulfonic acid;2-[[4-amino-2-methyl-5-(4-sulfobutoxy)phenyl]diazenyl]-5-methoxybenzenesulfonic acid.
| Compound Name | 4-(2-amino-4-methylphenoxy)butane-1-sulfonic acid;2-[[4-amino-2-methyl-5-(4-sulfobutoxy)phenyl]diazenyl]-5-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 158421445 |
| Molecular Formula | C29H40N4O12S3 |
| Molecular Weight | 732.86 g/mol |
| Exact Mass | 732.18 |
| IUPAC Name | 4-(2-amino-4-methylphenoxy)butane-1-sulfonic acid;2-[[4-amino-2-methyl-5-(4-sulfobutoxy)phenyl]diazenyl]-5-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(/N=N/c2cc(OCCCCS(=O)(=O)O)c(N)cc2C)c(S(=O)(=O)O)c1.Cc1ccc(OCCCCS(=O)(=O)O)c(N)c1 |
| InChI | InChI=1S/C18H23N3O8S2.C11H17NO4S/c1-12-9-14(19)17(29-7-3-4-8-30(22,23)24)11-16(12)21-20-15-6-5-13(28-2)10-18(15)31(25,26)27;1-9-4-5-11(10(12)8-9)16-6-2-3-7-17(13,14)15/h5-6,9-11H,3-4,7-8,19H2,1-2H3,(H,22,23,24)(H,25,26,27);4-5,8H,2-3,6-7,12H2,1H3,(H,13,14,15)/b21-20+; |
| InChIKey | HANPDWKVPUZJOO-ANVLNOONSA-N |
| XLogP | 4.92 |
| TPSA | 267.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.86 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|