C18H29N3O8S2 — CID 143500687
2-amino-5-methoxybenzenesulfonic acid;3-(3-amino-4-methylphenoxy)propane-1-sulfonic acid;methanamine (PubChem CID 143500687) has the molecular formula C18H29N3O8S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-amino-5-methoxybenzenesulfonic acid;3-(3-amino-4-methylphenoxy)propane-1-sulfonic acid;methanamine.
| Compound Name | 2-amino-5-methoxybenzenesulfonic acid;3-(3-amino-4-methylphenoxy)propane-1-sulfonic acid;methanamine |
|---|---|
| PubChem CID | 143500687 |
| Molecular Formula | C18H29N3O8S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 2-amino-5-methoxybenzenesulfonic acid;3-(3-amino-4-methylphenoxy)propane-1-sulfonic acid;methanamine |
| SMILES | CN.COc1ccc(N)c(S(=O)(=O)O)c1.Cc1ccc(OCCCS(=O)(=O)O)cc1N |
| InChI | InChI=1S/C10H15NO4S.C7H9NO4S.CH5N/c1-8-3-4-9(7-10(8)11)15-5-2-6-16(12,13)14;1-12-5-2-3-6(8)7(4-5)13(9,10)11;1-2/h3-4,7H,2,5-6,11H2,1H3,(H,12,13,14);2-4H,8H2,1H3,(H,9,10,11);2H2,1H3 |
| InChIKey | ARMZPIPOSIPMIT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 205.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|