C21H23N3O7S2 — CID 88925293
7-[(4-amino-2,5-dimethylphenyl)diazenyl]-3-(3-sulfopropoxy)naphthalene-1-sulfonic acid (PubChem CID 88925293) has the molecular formula C21H23N3O7S2 and a molecular weight of 493.56 g/mol. Its IUPAC name is 7-[(4-amino-2,5-dimethylphenyl)diazenyl]-3-(3-sulfopropoxy)naphthalene-1-sulfonic acid.
| Compound Name | 7-[(4-amino-2,5-dimethylphenyl)diazenyl]-3-(3-sulfopropoxy)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 88925293 |
| Molecular Formula | C21H23N3O7S2 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 7-[(4-amino-2,5-dimethylphenyl)diazenyl]-3-(3-sulfopropoxy)naphthalene-1-sulfonic acid |
| SMILES | Cc1cc(/N=N/c2ccc3cc(OCCCS(=O)(=O)O)cc(S(=O)(=O)O)c3c2)c(C)cc1N |
| InChI | InChI=1S/C21H23N3O7S2/c1-13-9-20(14(2)8-19(13)22)24-23-16-5-4-15-10-17(31-6-3-7-32(25,26)27)12-21(18(15)11-16)33(28,29)30/h4-5,8-12H,3,6-7,22H2,1-2H3,(H,25,26,27)(H,28,29,30)/b24-23+ |
| InChIKey | YYZOASWRIYMVPK-WCWDXBQESA-N |
| XLogP | 4.36 |
| TPSA | 168.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|