C16H19N3O10S3 — CID 87945681
4-[[4-amino-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]benzene-1,3-disulfonic acid (PubChem CID 87945681) has the molecular formula C16H19N3O10S3 and a molecular weight of 509.54 g/mol. Its IUPAC name is 4-[[4-amino-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[[4-amino-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 87945681 |
| Molecular Formula | C16H19N3O10S3 |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | 4-[[4-amino-2-methyl-5-(3-sulfopropoxy)phenyl]diazenyl]benzene-1,3-disulfonic acid |
| SMILES | Cc1cc(N)c(OCCCS(=O)(=O)O)cc1/N=N/c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C16H19N3O10S3/c1-10-7-12(17)15(29-5-2-6-30(20,21)22)9-14(10)19-18-13-4-3-11(31(23,24)25)8-16(13)32(26,27)28/h3-4,7-9H,2,5-6,17H2,1H3,(H,20,21,22)(H,23,24,25)(H,26,27,28)/b19-18+ |
| InChIKey | QASBZTMEVJHDMN-VHEBQXMUSA-N |
| XLogP | 2.14 |
| TPSA | 223.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|