C16H17N3O6S — CID 59319169
3-[[4-amino-3-(3-sulfopropoxy)phenyl]diazenyl]benzoic acid (PubChem CID 59319169) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is 3-[[4-amino-3-(3-sulfopropoxy)phenyl]diazenyl]benzoic acid.
| Compound Name | 3-[[4-amino-3-(3-sulfopropoxy)phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 59319169 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-[[4-amino-3-(3-sulfopropoxy)phenyl]diazenyl]benzoic acid |
| SMILES | Nc1ccc(/N=N/c2cccc(C(=O)O)c2)cc1OCCCS(=O)(=O)O |
| InChI | InChI=1S/C16H17N3O6S/c17-14-6-5-13(10-15(14)25-7-2-8-26(22,23)24)19-18-12-4-1-3-11(9-12)16(20)21/h1,3-6,9-10H,2,7-8,17H2,(H,20,21)(H,22,23,24)/b19-18+ |
| InChIKey | YBMUEGCHOINOJQ-VHEBQXMUSA-N |
| XLogP | 3.04 |
| TPSA | 151.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|