C15H14F3N3O3S — CID 91548900
2-amino-4-methyl-5-[[4-methyl-3-(trifluoromethyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 91548900) has the molecular formula C15H14F3N3O3S and a molecular weight of 373.36 g/mol. Its IUPAC name is 2-amino-4-methyl-5-[[4-methyl-3-(trifluoromethyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-amino-4-methyl-5-[[4-methyl-3-(trifluoromethyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 91548900 |
| Molecular Formula | C15H14F3N3O3S |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-amino-4-methyl-5-[[4-methyl-3-(trifluoromethyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1cc(N)c(S(=O)(=O)O)cc1/N=N/c1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F3N3O3S/c1-8-3-4-10(6-11(8)15(16,17)18)20-21-13-7-14(25(22,23)24)12(19)5-9(13)2/h3-7H,19H2,1-2H3,(H,22,23,24)/b21-20+ |
| InChIKey | XNISQWSVUVXYFM-QZQOTICOSA-N |
| XLogP | 4.57 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|