C17H21N3O3S — CID 87788672
4-[(4-amino-3-tert-butyl-5-methylphenyl)diazenyl]benzenesulfonic acid (PubChem CID 87788672) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-[(4-amino-3-tert-butyl-5-methylphenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(4-amino-3-tert-butyl-5-methylphenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87788672 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-[(4-amino-3-tert-butyl-5-methylphenyl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1cc(/N=N/c2ccc(S(=O)(=O)O)cc2)cc(C(C)(C)C)c1N |
| InChI | InChI=1S/C17H21N3O3S/c1-11-9-13(10-15(16(11)18)17(2,3)4)20-19-12-5-7-14(8-6-12)24(21,22)23/h5-10H,18H2,1-4H3,(H,21,22,23)/b20-19+ |
| InChIKey | BXUZESVSRRBTHD-FMQUCBEESA-N |
| XLogP | 4.54 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|