C11H11N5O4S — CID 135508279
4-[(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)diazenyl]benzenesulfonic acid (PubChem CID 135508279) has the molecular formula C11H11N5O4S and a molecular weight of 309.31 g/mol. Its IUPAC name is 4-[(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135508279 |
| Molecular Formula | C11H11N5O4S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 4-[(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1nc(N)[nH]c(=O)c1/N=N/c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H11N5O4S/c1-6-9(10(17)14-11(12)13-6)16-15-7-2-4-8(5-3-7)21(18,19)20/h2-5H,1H3,(H,18,19,20)(H3,12,13,14,17)/b16-15+ |
| InChIKey | MEYONLPCTBOYKJ-FOCLMDBBSA-N |
| XLogP | 1.32 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|