C12H10N4O7S — CID 136714084
4-[(6-hydroxy-4-methyl-5-nitro-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonic acid (PubChem CID 136714084) has the molecular formula C12H10N4O7S and a molecular weight of 354.30 g/mol. Its IUPAC name is 4-[(6-hydroxy-4-methyl-5-nitro-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(6-hydroxy-4-methyl-5-nitro-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136714084 |
| Molecular Formula | C12H10N4O7S |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 4-[(6-hydroxy-4-methyl-5-nitro-2-oxo-1H-pyridin-3-yl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1c([N+](=O)[O-])c(O)[nH]c(=O)c1/N=N/c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H10N4O7S/c1-6-9(11(17)13-12(18)10(6)16(19)20)15-14-7-2-4-8(5-3-7)24(21,22)23/h2-5H,1H3,(H2,13,17,18)(H,21,22,23)/b15-14+ |
| InChIKey | IIAOMRIPGHIBGI-CCEZHUSRSA-N |
| XLogP | 1.96 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|