C17H13N3O6S — CID 136855701
3-hydroxy-4-[(3-methyl-4-nitrophenyl)diazenyl]naphthalene-1-sulfonic acid (PubChem CID 136855701) has the molecular formula C17H13N3O6S and a molecular weight of 387.37 g/mol. Its IUPAC name is 3-hydroxy-4-[(3-methyl-4-nitrophenyl)diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 3-hydroxy-4-[(3-methyl-4-nitrophenyl)diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 136855701 |
| Molecular Formula | C17H13N3O6S |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 3-hydroxy-4-[(3-methyl-4-nitrophenyl)diazenyl]naphthalene-1-sulfonic acid |
| SMILES | Cc1cc(/N=N/c2c(O)cc(S(=O)(=O)O)c3ccccc23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13N3O6S/c1-10-8-11(6-7-14(10)20(22)23)18-19-17-13-5-3-2-4-12(13)16(9-15(17)21)27(24,25)26/h2-9,21H,1H3,(H,24,25,26)/b19-18+ |
| InChIKey | QVPXESWYVPAUCN-VHEBQXMUSA-N |
| XLogP | 4.42 |
| TPSA | 142.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|