C18H14N2O7S — CID 23348337
4-hydroxy-3-[(3-methyl-4-nitrobenzoyl)amino]naphthalene-1-sulfonic acid (PubChem CID 23348337) has the molecular formula C18H14N2O7S and a molecular weight of 402.38 g/mol. Its IUPAC name is 4-hydroxy-3-[(3-methyl-4-nitrobenzoyl)amino]naphthalene-1-sulfonic acid.
| Compound Name | 4-hydroxy-3-[(3-methyl-4-nitrobenzoyl)amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 23348337 |
| Molecular Formula | C18H14N2O7S |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 4-hydroxy-3-[(3-methyl-4-nitrobenzoyl)amino]naphthalene-1-sulfonic acid |
| SMILES | Cc1cc(C(=O)Nc2cc(S(=O)(=O)O)c3ccccc3c2O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14N2O7S/c1-10-8-11(6-7-15(10)20(23)24)18(22)19-14-9-16(28(25,26)27)12-4-2-3-5-13(12)17(14)21/h2-9,21H,1H3,(H,19,22)(H,25,26,27) |
| InChIKey | MPUDJQVFJYNJGR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|